| Identification | |
| Name: | 1H-Benzimidazole,5,6-dichloro-1-ethyl-2-methyl- |
| Synonyms: | Benzimidazole,5,6-dichloro-1-ethyl-2-methyl- (6CI,7CI,8CI);1-Ethyl-2-methyl-5,6-dichlorobenzimidazole;5,6-Dichloro-1-ethyl-2-methylbenzimidazole; |
| CAS: | 3237-62-5 |
| EINECS: | 221-797-3 |
| Molecular Formula: | C10H10Cl2N2 |
| Molecular Weight: | 229.11 |
| InChI: | InChI=1/C10H10Cl2N2/c1-3-14-6(2)13-9-4-7(11)8(12)5-10(9)14/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.35 g/cm3 |
| Refractive index: | 1.62 |
| Appearance: | white to light yellow solid |
| Specification: |
1H-Benzimidazole,5,6-dichloro-1-ethyl-2-methyl- , its cas register number is 3237-62-5. It also can be called 5,6-Dichloro-1-ethyl-2-methylbenzimidazole ; N-Ethyl-2-methyl-5,6-dichlorobenzimidazole ; and 1-Ethyl-2-methyl-5,6-dichlorobenzimidazole . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
