| Identification | |
| Name: | Iodobenzene diacetate |
| Synonyms: | (Diacetoxyiodo)benzene; DIB; Iodobenzene diacetate; Phenyliodine(III) diacetate; Iodosobenzene diacetate; PIA; iodosylbenzene di(acetate); (Diacetoxyiodo)benzene |
| CAS: | 3240-34-4 |
| EINECS: | 221-808-1 |
| Molecular Formula: | C10H11IO4 |
| Molecular Weight: | 322.1 |
| InChI: | InChI=1/C10H11IO4/c1-8(12)14-11(15-9(2)13)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1479 |
| Melting Point: | 161-165 oC |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | white to light yellow crystal powder |
| Specification: |
? Iodobenzene diacetate (CAS NO.3240-34-4), its Synonyms are (Diacetoxyiodo)benzene ; Benzene, (diacetoxyiodo)- ; Benzene, (dihydroxyiodo)-, diacetate ; Benzene, iodoso-, diacetate ; Bis(acetato)phenyliodine ; Phenyliodine diacetate ; Phenyliodine(III) diacetate ; Phenyliodo diacetate ; Phenyliodoso acetate ; Phenyliodoso diacetate ; Phenyliodosyl diacetate ; Iodine, bis(acetato-O)phenyl- (9CI) ; Iodine, bis(acetato-kappaO)phenyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29310095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
