| Identification | |
| Name: | Furan, 3,4-dibromo- |
| Synonyms: | 3,4-Dibromofuran; |
| CAS: | 32460-02-9 |
| Molecular Formula: | C4H2Br2O |
| Molecular Weight: | 225.87 |
| InChI: | InChI=1/C4H2Br2O/c5-3-1-7-2-4(3)6/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.159 g/cm3 |
| Refractive index: | 1.562 |
| Specification: |
The cas register number of 3,4-Dibromofuran is 32460-02-9. It also can be called as Furan, 3,4-dibromo- and the Systematic name about this chemical is 3,4-dibromofuran. Physical properties about 3,4-Dibromofuran are: (1)ACD/LogP: 2.85; (2)ACD/LogD (pH 5.5): 2.85; (3)ACD/LogD (pH 7.4): 2.85; (4)ACD/BCF (pH 5.5): 86.25; (5)ACD/BCF (pH 7.4): 86.25; (6)ACD/KOC (pH 5.5): 845.69; (7)ACD/KOC (pH 7.4): 845.69; (8)#H bond acceptors: 1; (9)Polar Surface Area: 13.14Å2; (10)Index of Refraction: 1.562; (11)Molar Refractivity: 33.93 cm3; (12)Molar Volume: 104.5 cm3; (13)Polarizability: 13.45x10-24cm3; (14)Surface Tension: 39.5 dyne/cm; (15)Enthalpy of Vaporization: 39.68 kJ/mol; (16)Vapour Pressure: 1.4 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
