| Identification | |
| Name: | Hydrazine,(5-fluoro-2-methylphenyl)-, hydrochloride (1:1) |
| Synonyms: | Hydrazine,(5-fluoro-2-methylphenyl)-, monohydrochloride (9CI); Hydrazine,(5-fluoro-o-tolyl)-, hydrochloride (8CI); (5-Fluoro-2-methylphenyl)hydrazinehydrochloride |
| CAS: | 325-50-8 |
| Molecular Formula: | C7H9 F N2 . Cl H |
| Molecular Weight: | 176.62 |
| InChI: | InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.498g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
5-Fluoro-2-methylphenylhydrazine hydrochloride (325-50-8), a compound which also can be called for hydrazine, (5-fluoro-2-methylphenyl)-, hydrochloride (1:1) ,can be used for API intermediates. |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
