| Identification | |
| Name: | Oxirane, 2,3-dimethyl- |
| Synonyms: | Butane,2,3-epoxy- (8CI); 2,3-Butylene oxide; 2,3-Dimethyloxirane; 2,3-Epoxybutane;2-Butene epoxide; 2-Butene oxide; 2-Butylene oxide; b-Butylene oxide; b-Oxybutene |
| CAS: | 3266-23-7 |
| EINECS: | 221-877-8 |
| Molecular Formula: | C4H8 O |
| Molecular Weight: | 72.1 |
| InChI: | InChI=1/C4H8O/c1-3-4(2)5-3/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3271 |
| Boiling Point: | 56.5°Cat760mmHg |
| Density: | 0.804 |
| Stability: | No data. |
| Refractive index: | 1.395 |
| Water Solubility: | >=10 g/100 mL at 20 C |
| Solubility: | Soluble |
| Appearance: | Clear colorless liquid. |
| Specification: |
Epoxides, such as 2-Butene oxide, are highly reactive. They polymerize in the presence of catalysts or when heated. These polymerization reactions can be violent. Compounds in this group react with acids, bases, and oxidizing and reducing agents. They react, possibly violently with water in the presence of acid and other catalysts. |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
