| Identification |
| Name: | 1,2,4-Thiadiazolidine-3,5-dione,2-methyl-4-(phenylmethyl)- |
| Synonyms: | NP 01139;TDZD 8 |
| CAS: | 327036-89-5 |
| Molecular Formula: | C10H10 N2 O2 S |
| Molecular Weight: | 222.26 |
| InChI: | InChI=1/C10H10N2O2S/c1-11-9(13)12(10(14)15-11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 63-64.4 °C
|
| Flash Point: | 156.7°C |
| Boiling Point: | 335.5°Cat760mmHg |
| Density: | 1.375g/cm3 |
| Refractive index: | 1.645 |
| Appearance: | White Solid |
| Flash Point: | 156.7°C |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: | Glycogen Synthase Kinase-3? is a highly conserved ubiquitously expressed serine/threonine protein kinase involved in signal transduction cascades of multiple cellular processes. TDZD-8 is a thiadiazolidinone (TDZD) analogue that acts as a highly selectiv |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
