Identification |
Name: | 1,2,4-Thiadiazolidine-3,5-dione,2-methyl-4-(phenylmethyl)- |
Synonyms: | NP 01139;TDZD 8 |
CAS: | 327036-89-5 |
Molecular Formula: | C10H10 N2 O2 S |
Molecular Weight: | 222.26 |
InChI: | InChI=1/C10H10N2O2S/c1-11-9(13)12(10(14)15-11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
Molecular Structure: |
![(C10H10N2O2S) NP 01139;TDZD 8](https://img1.guidechem.com/chem/e/dict/20/327036-89-5.jpg) |
Properties |
Melting Point: | 63-64.4 °C
|
Flash Point: | 156.7°C |
Boiling Point: | 335.5°Cat760mmHg |
Density: | 1.375g/cm3 |
Refractive index: | 1.645 |
Appearance: | White Solid |
Flash Point: | 156.7°C |
Storage Temperature: | 2-8°C |
Color: | white |
Usage: | Glycogen Synthase Kinase-3? is a highly conserved ubiquitously expressed serine/threonine protein kinase involved in signal transduction cascades of multiple cellular processes. TDZD-8 is a thiadiazolidinone (TDZD) analogue that acts as a highly selectiv |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
![](/images/detail_15.png) |