| Identification | |
| Name: | Benzonitrile,3-chloro-5-fluoro- |
| Synonyms: | 5-Fluoro-3-chlorobenzonitrile; |
| CAS: | 327056-73-5 |
| Molecular Formula: | C7H3ClFN |
| Molecular Weight: | 155.56 |
| InChI: | InChI=1/C7H3ClFN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.33 g/cm3 |
| Refractive index: | 1.536 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
It's stable under normal temperatures and pressures.It should avoid incompatible materials such as strong Oxidizing agents . Its hazardous decomposition products Hydrogen chloride , Hydrogen cyanide , Nitrogen oxides , Carbon monoxide , Carbon dioxide, Hydrogen fluoride gas. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
