Identification |
Name: | 1H-Benz[de]isoquinoline-1,3(2H)-dione,6-methoxy-2-methyl- |
Synonyms: | Naphthalimide,4-methoxy-N-methyl- (7CI,8CI); 4-Methoxy-N-methyl-1,8-naphthalimide;4-Methoxynaphthalene-1,8-dicarboxylic methylimide; C.I. 56190; C.I. FluorescentBrightener 162; C.I. Fluorescent Brightening Agent 162; Fluorescent Brightener162; Fluorescent Brightening Agent 162; Mikawhite AT; Mikawhite AT CONC;N-Methyl-4-methoxy-1,8-naphthalimide |
CAS: | 3271-05-4 |
EINECS: | 221-895-6 |
Molecular Formula: | C14H11 N O3 |
Molecular Weight: | 241.26 |
InChI: | InChI=1/C14H11NO3/c1-15-13(16)9-5-3-4-8-11(18-2)7-6-10(12(8)9)14(15)17/h3-7H,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 214.9°C |
Boiling Point: | 431.7°Cat760mmHg |
Density: | 1.335g/cm3 |
Refractive index: | 1.662 |
Specification: |
4-Methoxy-N-methylnaphthalimide (3271-05-4) also can be called 4-Methoxy-1,8-naphthalic acid-N-methylimide ; 6-Methoxy-2-methyl-1H-benz(de)isoquinoline-1,3(2H)-dione ; 1H-Benz[de]isoquinoline-1,3(2H)-dione, 6-methoxy-2-methyl- ; and Naphthalimide, 4-methoxy-N-methyl- .
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 214.9°C |
Safety Data |
|
 |