| Identification | |
| Name: | Ethyl xanthogen ethyl formate |
| Synonyms: | Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester;AI3-19742;Ethyl xanthogen ethyl formate;NSC 403191;Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate;Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate;Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI);Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH));Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester;Thiodicarbonic acid, diethyl ester;O,O-diethyl dithiodicarbonate |
| CAS: | 3278-35-1 |
| EINECS: | 221-911-1 |
| Molecular Formula: | C6H10O3S2 |
| Molecular Weight: | 194.2718 |
| InChI: | InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 96.5°C |
| Boiling Point: | 236°C at 760 mmHg |
| Density: | 1.242g/cm3 |
| Refractive index: | 1.534 |
| Specification: |
Ethyl xanthogen ethyl formate , its CAS NO. is 3278-35-1, the synonyms are AI3-19742 ; EINECS 221-911-1 ; NSC 403191 ; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate ; Carbonic acid, dithio-, anhydrosulfide with O-ethyl |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 96.5°C |
| Safety Data | |
 |
|
