| Identification |
| Name: | Phosphorodichloridousacid, methyl ester (8CI,9CI) |
| Synonyms: | Methylphosphorodichloridite (6CI,7CI);Dichloro methyl phosphite;Dichloromethoxyphosphine;Methoxydichlorophosphine;Methoxyphosphonousdichloride;Methyl dichlorophosphinite;Methyl dichlorophosphite;O-Methylphosphorodichloridite; |
| CAS: | 3279-26-3 |
| EINECS: | 221-915-3 |
| Molecular Formula: | CH3Cl2OP |
| Molecular Weight: | 132.91 |
| InChI: | InChI=1/CH3Cl2OP/c1-4-5(2)3/h1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 8/PG 2 |
| Stability: | Flammable. |
| Refractive index: | n20/D 1.474(lit.) |
| Water Solubility: | Stability Flammable.Toxicology Harmful if swallowed and in contact with the skin.Corrosive - may cause burns. Eye, skin and respiratory irritant. Risk phrases (The mean |
| Solubility: | |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Storage Temperature: | −20°C |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| |
 |
