| Identification | |
| Name: | p-Ethoxyphenyl 3-pyridylketone |
| Synonyms: | p-Ethoxyphenyl 3-pyridylketone;(4-ethoxyphenyl)(pyridin-3-yl)methanone;Ketone, p-ethoxyphenyl 3-pyridyl;BRN 1458449;32921-15-6;5471-60-3;AC1Q5EJY;AC1L4L9D;KST-1A5951;AR-1A5794;(4-ethoxyphenyl)-pyridin-3-ylmethanone;LS-87195 |
| CAS: | 32921-15-6 |
| Molecular Formula: | C14H13NO2 |
| Molecular Weight: | 227.2585 |
| InChI: | InChI=1/C14H13NO2/c1-2-17-13-7-5-11(6-8-13)14(16)12-4-3-9-15-10-12/h3-10H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 183.7°C |
| Boiling Point: | 380.2°C at 760 mmHg |
| Density: | 1.129g/cm3 |
| Refractive index: | 1.563 |
| Specification: |
p-Ethoxyphenyl 3-pyridylketone , its cas register number is 32921-15-6. It also can be called BRN 1458449 ; and Ketone, p-ethoxyphenyl 3-pyridyl . |
| Flash Point: | 183.7°C |
| Safety Data | |
 |
|
