Identification |
Name: | 4(5H)-Thiazolone,2-amino-5-[[4-[2-(methyl-2-pyridinylamino)ethoxy]phenyl]methyl]- |
Synonyms: | 5-[4-[2-[N-Methyl-N-(2-pyridyl)amino]ethoxy]benzyl]-2-imino-4-thiazolidinone; |
CAS: | 329249-53-8 |
Molecular Formula: | C18H20N4O2S |
Molecular Weight: | 356.44 |
InChI: | InChI=1/C18H20N4O2S/c1-22(16-4-2-3-9-20-16)10-11-24-14-7-5-13(6-8-14)12-15-17(23)21-18(19)25-15/h2-9,15H,10-12H2,1H3,(H2,19,21,23) |
Molecular Structure: |
|
Properties |
Flash Point: | 296.2°C |
Boiling Point: | 566.1°C at 760 mmHg |
Density: | 1.31 |
Refractive index: | 1.656 |
Appearance: | Light gray to light brown powder |
Specification: |
The extinguishing agent of 2-Amino-5-[[4-[2-(methyl-2-pyridinylamino)ethoxy]phenyl]methyl]-4(5H)-thiazolone (CAS No.329249-53-8) are dry powder, foam, sand, carbon dioxide, water mist.
|
Flash Point: | 296.2°C |
Safety Data |
|
|