| Identification | |
| Name: | Ethyl 2-aminothiazole-5-carboxylate |
| Synonyms: | 2-Amino-5-(ethoxycarbonyl)thiazole;2-Aminothiazole-5-carboxylic acid ethyl ester;Ethyl 2-amino-1,3-thiazole-5-carboxylate;Ethyl 2-amino-5-thiazolecarboxylate;NSC 233051;Ethyl-2-aminothiazole-5-carboxylate; |
| CAS: | 32955-21-8 |
| Molecular Formula: | C6H8N2O2S |
| Molecular Weight: | 172.2 |
| InChI: | InChI=1/C6H8N2O2S/c1-2-10-5(9)4-3-8-6(7)11-4/h3H,2H2,1H3,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 144-148 |
| Density: | 1.336 g/cm3 |
| Refractive index: | 1.588 |
| Specification: |
?Ethyl 2-aminothiazole-5-carboxylate , its cas register number is 32955-21-8. It also can be called Ethyl 2-amino-1,3-thiazole-5-carboxylate ; and 2-Amino-5-(ethoxycarbonyl)thiazole . |
| Safety Data | |
 |
|
