| Identification | ||
| Name: | Urea,N'-(3,4-dichlorophenyl)-N-methoxy-N-methyl- | |
| Synonyms: | Urea,3-(3,4-dichlorophenyl)-1-methoxy-1-methyl- (6CI,7CI,8CI);1-(3,4-Dichlorophenyl)-3-methoxy-3-methylurea;1-Methoxy-1-methyl-3-(3,4-dichlorophenyl)urea;3-(3,4-Dichlorophenyl)-1-methoxy-1-methylurea;3-(3,4-Dichlorophenyl)-1-methyl-1-methoxyurea;Afalon;Afalon inuron;Alfalon;Aphalon;Cephalon;Du Pont 326;Du Pont Herbicide 326;Herbicide 326;Linex;Linurex;Linuron;Liron;Lorex;Lorox;Methoxydiuron;N-(3,4-Dichlorophenyl)-N'-methoxy-N'-methylurea;N'-(3,4-Dichlorophenyl)-N-methoxy-N-methylurea;Sarclex;Sinuron; | |
| CAS: | 330-55-2 | |
| EINECS: | 206-356-5 | |
| Molecular Formula: | C9H10Cl2N2O2 | |
| Molecular Weight: | 249.09 | |
| InChI: | InChI=1/C9H10Cl2N2O2/c1-13(15-2)9(14)12-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3,(H,12,14) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 3077 | |
| Density: | 1.49 g/cm3 (20 C) | |
| Stability: | It is stable at its melting point and in neutral aqueous media. Dry formulations are stable under normal storage conditions. Hydrolyzed slowly by acids and alkalis at normal temperatures, and more rapidly at higher temperatures. | |
| Refractive index: | 1.6 | |
| Water Solubility: | ||
| Solubility: | 0.0075 g/100 mL | |
| Appearance: | solid | |
| Color: | White crystalline solid Colorless crystals Fine flakes or coarse powder | |
| Usage: | Herbicide. | |
| Safety Data | ||
 |
||
