| Identification | |
| Name: | Heptanedioic acid,1-ethyl ester |
| Synonyms: | Heptanedioicacid, monoethyl ester (9CI); Pimelic acid, ethyl ester (6CI); Pimelic acid,monoethyl ester (8CI); Ethyl hydrogen pimelate; Monoethyl heptanedioate;Monoethyl pimelate |
| CAS: | 33018-91-6 |
| EINECS: | 251-346-6 |
| Molecular Formula: | C9H16 O4 |
| Molecular Weight: | 188.22 |
| InChI: | InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.074 g/cm3 |
| Refractive index: | 1.4420 |
| Specification: |
Ethyl hydrogen heptane-1,7-dioate ,its cas register number is 33018-91-6.It also can be called Boc-methr(bzl)-OH ; Monoethyl pimelate ; Ethyl hydrogen pimelate and Heptanedioic acid monoethyl ester . |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
