| Identification | |
| Name: | Benzaldehyde,2-fluoro-4-methoxy- |
| Synonyms: | p-Anisaldehyde,2-fluoro- (8CI);4-Methoxy-2-fluorobenzaldehyde; |
| CAS: | 331-64-6 |
| Molecular Formula: | C8H7FO2 |
| Molecular Weight: | 154.14 |
| InChI: | InChI=1/C8H7FO2/c1-11-7-3-2-6(5-10)8(9)4-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.192 g/cm3 |
| Refractive index: | 1.525 |
| Appearance: | white to off-white crystalline solid |
| Specification: |
2-Fluoro-4-methoxybenzaldehyde (CAS No.331-64-6), it also can be called 2-Fluoro-p-anisaldehyde ; Benzaldehyde, 2-fluoro-4-methoxy- ; 3-Fluoro-4-methoxybenzonitrile ; Benzoic acid, 2-methoxy-3-(trifluoromethyl)- . It should be avoid breathing dust, vapor, mist, or gas. avoid contact with skin and eyes. And it should be stored in a cool, dry place. Store in a tightly closed container. Store under an inert atmosphere . |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
