| Identification | |
| Name: | 1H-Pyrazol-3-amine,4,5-dihydro-1-phenyl- |
| Synonyms: | 2-Pyrazoline,3-amino-1-phenyl- (6CI,7CI,8CI); 3-Amino-1-phenyl-2-pyrazoline;3-Amino-1-phenyl-4,5-dihydropyrazole; 3-Amino-1-phenylpyrazoline; NSC 162874 |
| CAS: | 3314-35-0 |
| EINECS: | 222-005-9 |
| Molecular Formula: | C9H11 N3 |
| Molecular Weight: | 161.20 |
| InChI: | InChI=1/C9H11N3/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.21 g/cm3 |
| Refractive index: | 1.641 |
| Specification: |
3-Amino-1-phenyl-2-pyrazolin , its cas register number is 3314-35-0. It also can be called 1-Fenyl-3-aminopyrazolin ; 3-Amino-1-fenyl-2-pyrazolin ; 3-Amino-1-phenyl-2-pyrazoline ; -Amino-1-phenylpyrazole ; EINECS 222-005-9 ; NSC 162874 ; Pyrazolidine, 3-imino-1-phenyl- . When heated to decomposition it emits toxic fumes of NOx. 3-Amino-1-phenyl-2-pyrazolin (CAS NO.3314-35-0) is moderately toxic skin irritant and severe eye irritant. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. Wear suitable gloves and eye/face protection when contact with it. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
