Identification |
Name: | Glycine, N,N-dimethyl-,ethyl ester |
Synonyms: | Dimethylglycineethyl ester;Ethyl (N,N-dimethylamino)acetate;Ethyl (dimethylamino)acetate;Ethyl 2-(dimethylamino)acetate;Ethyl N,N-dimethylglycinate;Ethyldimethylglycinate;N,N-Dimethylglycine ethyl ester; |
CAS: | 33229-89-9 |
EINECS: | 251-411-9 |
Molecular Formula: | C6H13NO2 |
Molecular Weight: | 178.18 |
InChI: | InChI=1S/C6H13NO2/c1-4-9-6(8)5-7(2)3/h4-5H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1993 3/PG 3 |
Flash Point: | 46.2°C |
Boiling Point: | 150.5°Cat760mmHg |
Density: | 0.948g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. |
Refractive index: | n20/D 1.413(lit.) |
Appearance: | colourless to slightly yellow-green liquid |
Packinggroup: | III |
Flash Point: | 46.2°C |
Storage Temperature: | Flammables area |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |