Identification |
Name: | Acetic acid,dianhydride with phosphoric acid, sodium salt (9CI) |
Synonyms: | Aceticacid, dianhydride with phosphoric acid sodium salt (8CI); Sodium diacetylphosphate |
CAS: | 33249-27-3 |
EINECS: | 251-427-6 |
Molecular Formula: | C4H7 O6 P . Na |
Molecular Weight: | 204.050371 |
InChI: | InChI=1/C4H6O2.Na.H3O4P/c1-3(5)4(2)6;;1-5(2,3)4/h1-2H3;;(H3,1,2,3,4)/q;+1;/p-3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 5.5°C |
Boiling Point: | 88°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 5.5°C |
Safety Data |
|
 |