| Identification | |
| Name: | 2-Furoic acid hydrazide |
| Synonyms: | 2-Furoic hydrazide; 2-furohydrazide; 2-furancarbohydrazonicacid; 2-furancarbonylhydrazide; 2-furancarboxylicacid,hydrazide; 2-furoylhydrazide; 2-furylcarbonylhydrazide; 2-furylcarboxylicacidhydrazide; pyromucicacidhydrazide; AKOS BBS-00004105 |
| CAS: | 3326-71-4 |
| EINECS: | 222-046-2 |
| Molecular Formula: | C5H6N2O2 |
| Molecular Weight: | 126.11 |
| InChI: | InChI=1/C5H6N2O2/c6-7-5(8)4-2-1-3-9-4/h1-3H,6H2,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.264g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.535 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | white to off-white crystalline powder |
| Specification: |
2-Furancarboxylic acid,hydrazide , with CAS number of 3326-71-4, can be called 2-furancarbohydrazonicacid ; 2-furancarbonylhydrazide ; 2-furancarboxylicacid,hydrazide ; 2-furoylhydrazide ; 2-furylcarbonylhydrazide ; 2-furylcarboxylicacidhydrazide ; pyromucicacidhydrazide ; AKOS BBS-00004105 .It is a beige crystal. |
| HS Code: | 29321900 |
| Flash Point: | °C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
