| Identification | |
| Name: | Ethanone,1-(2-methyl-1,3-dithiolan-2-yl)- |
| Synonyms: | Ketone,methyl 2-methyl-1,3-dithiolan-2-yl (8CI); 2-Acetyl-2-methyl-1,3-dithialane;2-Acetyl-2-methyl-1,3-dithiolane |
| CAS: | 33266-07-8 |
| Molecular Formula: | C6H10 O S2 |
| Molecular Weight: | 162.28 |
| InChI: | InChI=1/C6H10OS2/c1-5(7)6(2)8-3-4-9-6/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 106.7°C |
| Boiling Point: | 253.2°Cat760mmHg |
| Density: | 1.181g/cm3 |
| Refractive index: | 1.553 |
| Specification: |
2-Acetyl-2-methyl-1,3-dithiolane ,its cas register number is 33266-07-8. It also can be called 1,3-Dithiolane, 2-acetyl-2-methyl- ; and Ketone, methyl 2-methyl-1,3-dithiolan-2-yl . |
| Flash Point: | 106.7°C |
| Safety Data | |
 |
|
