| Identification | |
| Name: | 1,3-Benzenedicarboxaldehyde,2-hydroxy- |
| Synonyms: | Isophthalaldehyde,2-hydroxy- (7CI,8CI); 2,6-Diformylphenol;2-Hydroxy-1,3-benzenedicarboxaldehyde; 2-Hydroxyisophthalaldehyde; NSC 403253 |
| CAS: | 3328-69-6 |
| Molecular Formula: | C8H6 O3 |
| Molecular Weight: | 150.13 |
| InChI: | InChI=1/C8H6O3/c9-4-6-2-1-3-7(5-10)8(6)11/h1-5,11H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 124 °C |
| Flash Point: | 100.5°C |
| Boiling Point: | 219°Cat760mmHg |
| Density: | 1.35g/cm3 |
| Refractive index: | 1.672 |
| Specification: |
The 2-Hydroxyisophthalaldehyde with the cas number 3328-69-6 is also called 1,3-Benzenedicarboxaldehyde,2-hydroxy-. Both the systematic name and IUPAC name are 2-hydroxybenzene-1,3-dicarbaldehyde. Its molecular formula is C8H6O3. This chemical should stored at Refrigerator. The properties of the chemical are: (1)ACD/LogP: 2.01; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 43.37 Å2; (7)Index of Refraction: 1.672; (8)Molar Refractivity: 41.64 cm3; (9)Molar Volume: 111.1 cm3; (10)Polarizability: 16.5×10-24cm3; (11)Surface Tension: 62.3 dyne/cm; (12)Enthalpy of Vaporization: 47.4 kJ/mol; (13)Vapour Pressure: 0.0827 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 100.5°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
 |
|
