| Identification | |
| Name: | 1,8-Naphthyridine-2-ethanamine,5,6,7,8-tetrahydro- |
| Synonyms: | 1,8-Naphthyridine-2-ethanamine,1,5,6,7-tetrahydro- (9CI); 2-(5,6,7,8-Tetrahydro-1,8-naphthyridin-2-yl)ethylamine |
| CAS: | 332884-13-6 |
| Molecular Formula: | C10H15 N3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H15N3/c11-6-5-9-4-3-8-2-1-7-12-10(8)13-9/h3-4H,1-2,5-7,11H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 163.3°C |
| Boiling Point: | 346.3°Cat760mmHg |
| Density: | 1.094g/cm3 |
| Refractive index: | 1.567 |
| Specification: |
The systematic name of 5,6,7,8-Tetrahydro-1,8-naphthyridin-2-ethylamine is 2-(5,6,7,8-Tetrahydro-1,8-naphthyridin-2-yl)ethanamine. With the CAS registry number 332884-13-6, it is also named as . The product's category is 1,8-Naphthyridine-2-ethanamine,5,6,7,8-tetrahydro-. In addition, its molecular formula is C10H15N3 and its molecular weight is 177.25. The other characteristics of 5,6,7,8-Tetrahydro-1,8-naphthyridin-2-ethylamine can be summarized as: (1)ACD/LogP: 1.01; (2)# of Rule of 5 Violations: 0; (3)H bond acceptors: 3; (4)H bond donors: 3; (5)Freely Rotating Bonds: 3; (6)Polar Surface Area: 50.94 Å2; (7)Index of Refraction: 1.567; (8)Molar Refractivity: 52.95 cm3; (9)Molar Volume: 162 cm3; (10)Polarizability: 20.99×10-24cm3; (11)Surface Tension: 47.8 dyne/cm; (12)Density: 1.094 g/cm3; (13)Flash Point: 163.3 °C; (14)Enthalpy of Vaporization: 59.05 kJ/mol; (15)Boiling Point: 346.3 °C at 760 mmHg; (16)Vapour Pressure: 5.8E-05 mmHg at 25 °C. People can use the following data to convert to the molecule structure. |
| Flash Point: | 163.3°C |
| Safety Data | |
 |
|
