| Identification | |
| Name: | 2H-Indol-2-one,1,3-dihydro-1-phenyl- |
| Synonyms: | 2-Indolinone,1-phenyl- (7CI);Oxindole, 1-phenyl- (6CI);1,3-Dihydro-1-phenyl-2H-indol-2-one;1-Phenyl-1,3-dihydro-2H-indol-2-one;1-Phenyl-2-indolinone;1-Phenyloxindole;N-Phenyl-2-indolinone;NSC 234518; |
| CAS: | 3335-98-6 |
| Molecular Formula: | C14H11NO |
| Molecular Weight: | 209.25 |
| InChI: | InChI=1/C14H11NO/c16-14-10-11-6-4-5-9-13(11)15(14)12-7-2-1-3-8-12/h1-9H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 123-125ºC |
| Density: | 1.228 g/cm3 |
| Refractive index: | 1.648 |
| Appearance: | White or white powder category |
| Specification: |
2H-Indol-2-one,1,3-dihydro-1-phenyl- , with CAS number of 3335-98-6, can be called 1,3-Dihydro-1-phenyl-2h-indol-2-one ; 1,3-dihydro-1-phenyl-2h-indole-2-one ; 1-phenyl-1,3-dihydro-2h-indol-2-one ; 1-phenyloxindole ; 1-phenylindolin-2-one;phenyloxindole ; n-phenyl-2-indolinone ; n-phenyloxindole . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
