| Identification | |
| Name: | Estrone 17-methoxime |
| Synonyms: | 3-Hydroxy-1,3,5(10)-estratrien-17-one O-methyl oxime;3-Hydroxyestra-1,3,5(10)-trien-17-one O-methyl oxime;Estrone O-methyloxime |
| CAS: | 3342-64-1 |
| Molecular Formula: | C19H25NO2 |
| Molecular Weight: | 299.4073 |
| InChI: | InChI=1S/C19H25NO2/c1-19-10-9-15-14-6-4-13(21)11-12(14)3-5-16(15)17(19)7-8-18(19)20-22-2/h4,6,11,15-17,21H,3,5,7-10H2,1-2H3/b20-18+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 227.418°C |
| Boiling Point: | 452.424°C at 760 mmHg |
| Density: | 1.266g/cm3 |
| Refractive index: | 1.642 |
| Specification: |
The extinguishing agent of Estrone 17-methoxime (CAS No.3342-64-1) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 227.418°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
