| Identification | |
| Name: | 2-Pyridinamine,5-phenyl- |
| Synonyms: | Pyridine,2-amino-5-phenyl- (8CI); 2-Amino-5-phenylpyridine; 5-Phenyl-2-pyridinamine;5-Phenylpyridin-2-ylamine; Phe-P 1 |
| CAS: | 33421-40-8 |
| Molecular Formula: | C11H10 N2 |
| Molecular Weight: | 170.214 |
| InChI: | InChI=1/C11H10N2/c12-11-7-6-10(8-13-11)9-4-2-1-3-5-9/h1-8H,(H2,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 132 °C |
| Flash Point: | 175.6°C |
| Boiling Point: | 323.6°Cat760mmHg |
| Density: | 1.133g/cm3 |
| Refractive index: | 1.625 |
| Specification: |
2-Amino-5-phenylpyridine with cas registry number of 33421-40-8 is also known as 5-Phenyl-2-pyridinamine ; 5-22-10-00457 (Beilstein Handbook Reference) ; Phe-P-1 ; 2-Pyridinamine, 5-phenyl- ; Pyridine, 2-amino-5-phenyl- . |
| Flash Point: | 175.6°C |
| Usage: | A product from the pyrolysis of phenylalanine |
| Safety Data | |
 |
|
