| Identification | |
| Name: | Dibenzo[b,e][1,4]dioxin,1,3,6,8-tetrachloro- |
| Synonyms: | Dibenzo-p-dioxin,1,3,6,8-tetrachloro- (8CI); 1,3,6,8-Tetrachlorobenzo-p-dioxin;1,3,6,8-Tetrachlorodibenzo-p-dioxin; 1,3,6,8-Tetrachlorodibenzo[1,4]dioxin;1,3,6,8-Tetrachlorodibenzodioxin; PCDD 42 |
| CAS: | 33423-92-6 |
| Molecular Formula: | C12H4 Cl4 O2 |
| Molecular Weight: | 321.96 |
| InChI: | InChI=1S/C12H4Cl4O2/c13-5-1-7(15)11-9(3-5)18-12-8(16)2-6(14)4-10(12)17-11/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 161.7°C |
| Boiling Point: | 413°Cat760mmHg |
| Density: | 1.643g/cm3 |
| Refractive index: | 1.655 |
| Report: |
IARC Cancer Review: Animal Inadequate Evidence IMEMDT IARC Monographs on the Evaluation of Carcinogenic Risk of Chemicals to Man . 15 ,1977,p. 41.(World Health Organization, Internation Agency for Research on Cancer,Lyon, France.: ) (Single copies can be ordered from WHO Publications Centre U.S.A., 49 Sheridan Avenue, Albany, NY 12210) . |
| Packinggroup: | I |
| Flash Point: | 161.7°C |
| Safety Data | |
 |
|
