| Identification | |
| Name: | Benzeneundecanoic acid |
| Synonyms: | Undecanoicacid, 11-phenyl- (6CI,7CI,8CI); 11-Phenylundecanoic acid |
| CAS: | 3343-24-6 |
| EINECS: | 222-087-6 |
| Molecular Formula: | C17H26 O2 |
| Molecular Weight: | 262.39 |
| InChI: | InChI=1/C17H26O2/c18-17(19)15-11-6-4-2-1-3-5-8-12-16-13-9-7-10-14-16/h7,9-10,13-14H,1-6,8,11-12,15H2,(H,18,19) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 298.7°C |
| Boiling Point: | 401.9°Cat760mmHg |
| Density: | 0.988g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.507 |
| Appearance: | colourless to yellow liquid |
| Flash Point: | 298.7°C |
| Safety Data | |
 |
|
