| Identification |
| Name: | 1,8-Naphthyridine-3-carboxylic acid, 6-bromo-1,2,3,4-tetrahydro-2-oxo-, methyl ester |
| Synonyms: | Methyl 6-bromo-2-oxo-2,3,4,8-tetrahydro-1,8-naphthyridine-3-carboxylate;methyl 6-bromo-2-oxo-1,2,3,4-tetrahydro-1,8-naphthyridine-3-carboxylate;Methyl 6-bromo-2-oxo-2,3,4,8-tetrahydro-1,8-naphthyridine-3-carboxylate; |
| CAS: | 335031-10-2 |
| Molecular Formula: | C10H9BrN2O3 |
| Molecular Weight: | 285.09 |
| InChI: | InChI=1/C10H9BrN2O3/c1-16-10(15)7-3-5-2-6(11)4-12-8(5)13-9(7)14/h2,4,7H,3H2,1H3,(H,12,13,14) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 219.279°C |
| Boiling Point: | 438.965°C at 760 mmHg |
| Density: | 1.622g/cm3 |
| Refractive index: | 1.582 |
| Flash Point: | 219.279°C |
| Usage: | Intermediate in the production of FabI inhibitors |
| Safety Data |
| |
 |
