| Identification | |
| Name: | N,N-Diethyldodecanamide |
| Synonyms: | Diethyllauramide;Dodecanamide,N,N-diethyl-;N,N-Diethyllauramide;N,N-Diethyllaurylamide;NSC3890;NSC 406286;n-Dodecanoic acid diethylamide; |
| CAS: | 3352-87-2 |
| EINECS: | 222-118-3 |
| Molecular Formula: | C16H33NO |
| Molecular Weight: | 255.44 |
| InChI: | InChI=1/C16H33NO/c1-4-7-8-9-10-11-12-13-14-15-16(18)17(5-2)6-3/h4-15H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.84 |
| Refractive index: | n20/D 1.454(lit.) |
| Appearance: | Colorless to pale yellow liquid |
| Specification: |
N,N-Diethyldodecanamide (CAS NO.3352-87-2) also can be called 4-04-00-00357 (Beilstein Handbook Reference) ; AI3-01019 ; BRN 1776541 ; Diethyllauramide ; Dodecanamide, N,N-diethyl- ; N,N-Diethyllauramide ; N,N-Diethyllaurylamide ; NSC 3890 ; NSC 406286 ; Nopcogen 14-l . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
