| Identification | |
| Name: | 1,3-Benzenediamine,5-chloro- |
| Synonyms: | m-Phenylenediamine,5-chloro- (8CI); 3,5-Diaminochlorobenzene; 3-Amino-5-chloroaniline;5-Amino-3-chloroaniline; 5-Chloro-1,3-benzenediamine;5-Chloro-1,3-diaminobenzene; 5-Chloro-1,3-phenylenediamine;5-Chloro-m-phenylenediamine |
| CAS: | 33786-89-9 |
| Molecular Formula: | C6H7 Cl N2 |
| Molecular Weight: | 142.58 |
| InChI: | InChI=1/C6H7ClN2/c7-4-1-5(8)3-6(9)2-4/h1-3H,8-9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 102-104°C |
| Flash Point: | 155.6°C |
| Boiling Point: | 333.6°Cat760mmHg |
| Density: | 1.345g/cm3 |
| Refractive index: | 1.67 |
| Specification: |
5-Chloro-1,3-benzenediamine , its cas register number is 33786-89-9. It also can be called 5-Chloro-m-phenylenediamine ; 1,3-Benzenediamine, 5-chloro- ; and 5-Chloro-1,3-diaminobenzene . It is toxic substances,and when heated to decomposition, it emits toxic vapors of NOx and Cl−. When breathing is difficult, give oxygen. And as soon as to get medical aid. In addition, 5-Chloro-1,3-benzenediamine should be keep dry and cold air. |
| Packinggroup: | III |
| Flash Point: | 155.6°C |
| Safety Data | |
 |
|
