| Identification | |
| Name: | D-Alanine |
| Synonyms: | D-alpha-Aminopropionsaeure;Ba 2776;D-alpha-alanine;(R)-2-Aminopropionsaeure;D-alpha-aminopropionic acid;D(-)-Alanine;H-D-Ala-OH;Alanine D-;D-Ala;D-Ala-OH;D-Alanine;D(-)-.alpha.-Alanine;(2R)-2-aminopropanoic acid;D-.alpha.-Alanine;Alanine, D-;(R)-2-aminopropanoic acid;D-Alanin;(R)-Alanine;D-2-Aminopropionic acid;Alanine D-form;D-(-)-Alanine; |
| CAS: | 338-69-2 |
| EINECS: | 206-418-1 |
| Molecular Formula: | C3H7NO2 |
| Molecular Weight: | 89.09 |
| InChI: | InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 82.6oC |
| Boiling Point: | 212.9oCat760mmHg |
| Density: | 1.161g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -14.5 o (C=10, 6N HCL) |
| Solubility: | & |
| Appearance: | White crystalline powder |
| Flash Point: | 82.6oC |
| Storage Temperature: | Store at RT. |
| Color: | Orthorhombic crystals from water White crystalline powder |
| Usage: | One of the 20 proteinogenic amino acids. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
