| Identification | |
| Name: | Bicyclo[3.1.0]hexane,4-methylene-1-(1-methylethyl)- |
| Synonyms: | 4(10)-Thujene(6CI,7CI,8CI); 1-Isopropyl-4-methylenebicyclo[3.1.0]hexane;4-Methylene-1-(1-methylethyl)-bicyclo[3.1.0]hexane; NSC 407278; Sabenene;Sabinen; Sabinene |
| CAS: | 3387-41-5 |
| EINECS: | 222-212-4 |
| Molecular Formula: | C10H16 |
| Molecular Weight: | 136.23 |
| InChI: | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3 |
| Molecular Structure: | ![(C10H16) 4(10)-Thujene(6CI,7CI,8CI); 1-Isopropyl-4-methylenebicyclo[3.1.0]hexane;4-Methylene-1-(1-methylethyl...](https://img1.guidechem.com/chem/e/dict/31/3387-41-5.jpg) |
| Properties | |
| Transport: | 1993 |
| Flash Point: | 36.7°C |
| Boiling Point: | 164°Cat760mmHg |
| Density: | 0.88g/cm3 |
| Specification: |
Sabinene (CAS NO.3387-41-5) is one of the chemical compounds that contributes to the spiciness of black pepper and is a major constituent of carrot seed oil. |
| Packinggroup: | III |
| Flash Point: | 36.7°C |
| Safety Data | |
 |
|
