| Identification | |
| Name: | Propanenitrile,3-chloro-2-hydroxy- |
| Synonyms: | Lactonitrile,3-chloro- (6CI,7CI,8CI); 3-Chlorolactonitrile |
| CAS: | 33965-80-9 |
| EINECS: | 251-765-4 |
| Molecular Formula: | C3H4 Cl N O |
| Molecular Weight: | 105.53 |
| InChI: | InChI=1/C3H4ClNO/c4-1-3(6)2-5/h3,6H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.3°C |
| Boiling Point: | 258.8°Cat760mmHg |
| Density: | 1.307g/cm3 |
| Refractive index: | 1.462 |
| Specification: |
3-Chlorolactonitrile ,its CAS NO. is 33965-80-9, the synonyms are BRN 1742038 ; Lactonitrile, beta-chloro- ; beta-Chlorolactonitrile ; 3-Chloro-2-hydroxypropiononitrile ; Lactonitrile, 3-chloro- . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 110.3°C |
| Safety Data | |
 |
|
