| Identification | |
| Name: | 8-Quinolinethiol,hydrochloride (1:1) |
| Synonyms: | 8-Quinolinethiol,hydrochloride (8CI,9CI); 8-Mecaptoquinoline hydrochloride; 8-Mercaptoquinolinehydrochloride; Thiooxine hydrochloride; Thioxine hydrochloride |
| CAS: | 34006-16-1 |
| EINECS: | 251-785-3 |
| Molecular Formula: | C9H7 N S . Cl H |
| Molecular Weight: | 197.68 |
| InChI: | InChI=1/C9H7NS.ClH/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 137.5°C |
| Boiling Point: | 303.8°Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
Quinoline-8-thiol hydrochloride , its cas register number is 34006-16-1. It also can be called EINECS 251-785-3 ; Quinoline-8-thiol HCl .It is a white to light yellow crystal powder. |
| Flash Point: | 137.5°C |
| Storage Temperature: | 2-8°C |
| Color: | yellow |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
