| Identification | |
| Name: | 3,4-Difluorobenzaldehyde |
| Synonyms: | Benzaldehyde, 3,4-difluoro-; |
| CAS: | 34036-07-2 |
| EINECS: | 422-180-3 |
| Molecular Formula: | C7H4F2O |
| Molecular Weight: | 142.102866 |
| InChI: | InChI=1S/C7H4F2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.292 |
| Refractive index: | 1.499-1.501 |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | Light Yellow Clear Liquid |
| Specification: |
? 3,4-difluorobenzaldehyde , with CAS number of 34036-07-2, can be called 3.4-Difluoro benzaldehyde ; 3,4-Difluorobenzaldehyde ; 3,4-fluorobenzaldehyde . It is a light yellow clear liquid,?3,4-difluorobenzaldehyde (CAS NO.34036-07-2) can be used for Medicine, Pesticide, intermediates of LCD materials. |
| Sensitive: | Air Sensitive |
| Usage: | Metabolic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
