Identification |
Name: | Benzenemethanol, a-[1-(diethylamino)ethyl]-,(R*,R*)- (9CI) |
Synonyms: | Benzylalcohol, a-[1-(diethylamino)ethyl]-, threo-(8CI); threo-1-Phenyl-2-diethylamino-1-propanol |
CAS: | 34154-81-9 |
Molecular Formula: | C13H21 N O |
Molecular Weight: | 0 |
InChI: | InChI=1/C13H21NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11,13,15H,4-5H2,1-3H3/t11-,13+/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 111.939°C |
Boiling Point: | 311.36°C at 760 mmHg |
Density: | 0.984g/cm3 |
Refractive index: | 1.521 |
Flash Point: | 111.939°C |
Usage: | The main basic metabolite of Diethylpropione |
Safety Data |
|
|