| Identification | |
| Name: | L-Tyrosine methyl ester hydrochloride |
| Synonyms: | H-Tyr-OMe.HCl |
| CAS: | 3417-91-2 |
| EINECS: | 222-313-3 |
| Molecular Formula: | C10H13NO3?HCl |
| Molecular Weight: | 231.68 |
| InChI: | InChI=1/C10H13NO3.ClH/c1-14-10(13)9(11)6-7-2-4-8(12)5-3-7;/h2-5,9,12H,6,11H2,1H3;1H/t9-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 153.4 oC |
| Boiling Point: | 330oC at 760 mmHg |
| Density: | 1.21g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 74 o (C=3,1N PYRIDINE) |
| Appearance: | White to off-white crystalline powder |
| HS Code: | 29225000 |
| Flash Point: | 153.4 oC |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
