| Identification | |
| Name: | Inosine,6-S-methyl-6-thio- |
| Synonyms: | 9H-Purine,6-(methylthio)-9-b-D-ribofuranosyl-(6CI,7CI,8CI); 6-(Methylmercapto)-9-(b-D-ribofuranosyl)purine; 6-(Methylmercapto)purineribonucleoside; 6-(Methylthio)-9-b-D-ribofuranosyl-9H-purine; 6-(Methylthio)-9-b-D-ribofuranosylpurine; 6-(Methylthio)purineribonucleoside; 6-MMPR; 6-Methylmercaptopurine riboside; 6-Methylthioinosine;6-Methylthiopurine riboside; Methylthioinosine; NSC 40774; NSC 49555; SQ 21977;b-D-Ribosyl-6-methylthiopurine |
| CAS: | 342-69-8 |
| EINECS: | 206-442-2 |
| Molecular Formula: | C11H14 N4 O4 S |
| Molecular Weight: | 298.31826 |
| InChI: | InChI=1S/C11H14N4O4S/c1-20-10-6-9(12-3-13-10)15(4-14-6)11-8(18)7(17)5(2-16)19-11/h3-5,7-8,11,16-18H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 338.6°C |
| Boiling Point: | 636.3°Cat760mmHg |
| Density: | 1.85g/cm3 |
| Stability: | Incompatible with strong oxidizing agents. |
| Refractive index: | 1.822 |
| Water Solubility: | slight Stability Incompatible with strong oxidizing agents. Toxicology Irritant. Toxicity data (The meaning of any toxicological abbreviations which appear in t |
| Solubility: | slight
|
| Appearance: | white powder |
| Report: |
NCI Carcinogenesis Studies (ipr); Equivocal Evidence: mouse CANCAR Cancer. 40 (1977),1935. ; (ipr); No Evidence: rat CANCAR Cancer. 40 (1977),1935. . |
| Flash Point: | 338.6°C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
