| Identification | |
| Name: | 2,4(1H,3H)-Pyrimidinedione,1-(2-deoxy-b-L-erythro-pentofuranosyl)-5-methyl- |
| Synonyms: | Thymine,1-(2-deoxy-b-L-erythro-pentofuranosyl)-(7CI,8CI);Epavudine;L-Thymidine;NV 02B;Telbivudine;b-L-Thymidine; |
| CAS: | 3424-98-4 |
| Molecular Formula: | C10H14N2O5 |
| Molecular Weight: | 242.23 |
| InChI: | InChI=1/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.452 g/cm3 |
| Refractive index: | 1.584 |
| Appearance: | white e crystal powder |
| Specification: |
Telbivudine , its cas register number is 3424-98-4. It also can be called 1-(2-Deoxy-beta-L-erythro-pentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione ; Epavudine ; L-Thymidine ; Telbivudin ; 2,4(1H,3H)-Pyrimidinedione,1-(2-deoxy-b-L-erythro-pentofuranosyl)-5-methyl- ; Tyzeka ; 2'-Deoxy-L-thymidine ; and beta-L-Thymidine . Its classification code are Antiviral and Treatment of hepatitis B infection. |
| Flash Point: | °C |
| Usage: |
Telbivudine (CAS NO.3424-98-4) can be used as Nucleoside analog ; specific inhibitor of hepatitis B virus (HBV) replication , and Antiviral . |
| Safety Data | |
 |
|
