| Identification | |
| Name: | DIMETHYLAMINE-2,3,6-TRICHLOROBENZOATE |
| Synonyms: | 2,3,6-tba,dimethylaminesalt;2,3,6-trichloro-benzoicacicompd.withdimethylamine(1:1);2kf;kf2;kyselina2,3,6-trichlorbenzoovadimethylamonnasul;methanamine,n-methyl-,2,3,6-trichlorobenzoate;polidim;trichlorobenzoicaciddimethylaminesalt |
| CAS: | 3426-62-8 |
| EINECS: | 222-329-0 |
| Molecular Formula: | C7H3Cl3O2 . C2H7N |
| Molecular Weight: | 270.55 |
| InChI: | InChI=1/C7H3Cl3O2.C2H7N/c8-3-1-2-4(9)6(10)5(3)7(11)12;1-3-2/h1-2H,(H,11,12);3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 150.1°C |
| Boiling Point: | 324.5°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
2,3,6-TBA-dimethylammonium [ISO] , its cas register number is 3426-62-8. It also can be called 2,3,6-TBA-dimethylammonium ; 2,3,6-Trichlorobenzoic acid dimethylamine salt ; Kyselina 2,3,6-trichlorbenzoova dimethylamonna sul ; and Methanamine, N-methyl-, 2,3,6-trichlorobenzoate . |
| Flash Point: | 150.1°C |
| Safety Data | |
 |
|
