| Identification | |
| Name: | Cyclohexanol,2-phenyl-, (1S,2R)- |
| Synonyms: | Cyclohexanol,2-phenyl-, (1S,2R)-(+)- (8CI); Cyclohexanol, 2-phenyl-, (1S-trans)-;(+)-trans-2-Phenyl-1-cyclohexanol; (+)-trans-2-Phenylcyclohexanol;(1S,2R)-(+)-trans-2-Phenyl-1-cyclohexanol; (1S,2R)-2-Phenyl-1-cyclohexanol;(1S,2R)-2-Phenylcyclohexanol; (1S-trans)-2-Phenylcyclohexanol;trans-(1S,2R)-2-Phenylcyclohexanol |
| CAS: | 34281-92-0 |
| EINECS: | 219-111-2 |
| Molecular Formula: | C12H16 O |
| Molecular Weight: | 176.25 |
| InChI: | InChI=1/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-13H,4-5,8-9H2/t11-,12+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 64-66 °C(lit.) |
| Flash Point: | 113.326°C |
| Boiling Point: | 276-281 °C(lit.) |
| Density: | 1.051g/cm3 |
| Refractive index: | 60 ° (C=10, MeOH) |
| Appearance: | white to light yellow crystal powde |
| Specification: |
(1S,2R)-(+)-trans-2-Phenyl-1-cyclohexanol (34281-92-0) is white to light yellow crystal powder. It is also known as Cyclohexanol, 2-phenyl-, trans- ; trans-2-Phenyl-1-cyclohexanol ; (1S,2R)-trans-2-Phenyl-1-cyclohexanol ; trans-2-Phenylcyclohexanol . |
| Flash Point: | 113.326°C |
| Safety Data | |
 |
|
