| Identification | |
| Name: | 2,5-Dibromo-3-picoline |
| Synonyms: | pyridine, 2,5-dibromo-3-methyl-;2,5-Dibromo-3-methylpyridine; |
| CAS: | 3430-18-0 |
| Molecular Formula: | C6H5Br2N |
| Molecular Weight: | 250.92 |
| InChI: | InChI=1/C6H5Br2N/c1-4-2-5(7)3-9-6(4)8/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 42-47 oC |
| Density: | 1.911 g/cm3 |
| Refractive index: | 1.593 |
| Appearance: | Off-white to beige crystalline powder |
| Specification: |
? 2,5-Dibromo-3-picoline , with CAS number of 3430-18-0, can be called 2,5-Dibromo-3-methylpyridine ; 2,5-Dibromo-3-methylpyridine ; pyridine, 2,5-dibromo-3-methyl- . It is an?off-white to beige crystalline powder. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
