| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2-bromo-3,5-dichloro- |
| Synonyms: | 2-BROMO-3,5-DICHLOROPYRIDINE-4-CARBOXYLIC ACID;2-BROMO-3,5-DICHLOROISONICOTINIC ACID |
| CAS: | 343781-56-6 |
| Molecular Formula: | C6H2 Br Cl2 N O2 |
| Molecular Weight: | 270.9 |
| InChI: | InChI=1/C6H2BrCl2NO2/c7-5-4(9)3(6(11)12)2(8)1-10-5/h1H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.002g/cm3 |
| Refractive index: | 1.64 |
| Specification: |
2-Bromo-3,5-dichloroisonicotinic acid with cas registry number of 343781-56-6 is also known as 2-Bromo-3,5-dichloropyridine-4-carboxylic acid ; 4-Pyridinecarboxylic acid, 2-bromo-3,5-dichloro- ; 2-Bromo-3,5-dichloro-4-pyridinecarboxylic acid . It would emit acrid smoke and irritating fumes when heated to decomposition . It should be stored in a cool, dry place and kept container closed when not in use. |
| Safety Data | |
 |
|
