| Identification | |
| Name: | 1-Octanamine,N-methyl-N-nitroso- |
| Synonyms: | Octylamine,N-methyl-N-nitroso- (8CI); N-Nitroso-N-methyl-n-octylamine;N-Nitroso-N-methyloctylamine |
| CAS: | 34423-54-6 |
| Molecular Formula: | C9H20 N2 O |
| Molecular Weight: | 172.31 |
| InChI: | InChI=1/C9H20N2O/c1-3-4-5-6-7-8-9-11(2)10-12/h3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.2°C |
| Boiling Point: | 268.6°Cat760mmHg |
| Density: | 0.91g/cm3 |
| Refractive index: | 1.459 |
| Specification: |
Nitroso-N-methyl-n-octylamine , its cas register number is 34423-54-6. It also can be called 1-Octylamine, N-methyl-N-nitroso- ; N-Nitrosomethyloctylamine ; and N-Methyl-N-nitrosooctylamine . |
| Flash Point: | 116.2°C |
| Safety Data | |
 |
|
