| Identification | |
| Name: | 4-(Methylthio)benzaldehyde |
| Synonyms: | Benzaldehyde,p-(methylthio)- (6CI,7CI,8CI);4-(Methylmercapto)benzaldehyde;4-Methanesulfanylbenzaldehyde;4-Methanethiobenzaldehyde;4-Methylsulfanylbenzaldehyde;Methyl 4-formylphenylthioether;p-(Methylthio)benzaldehyde; |
| CAS: | 3446-89-7 |
| EINECS: | 222-365-7 |
| Molecular Formula: | C8H8OS |
| Molecular Weight: | 152.21 |
| InChI: | InChI=1/C8H8OS/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 281 |
| Density: | 1.144 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.646 |
| Solubility: | Insoluble |
| Appearance: | Yellowish liquid |
| Specification: |
4-(methylthio)benzaldehyde , with CAS number of 3446-89-7, can be called p-(Methylthio)benzaldehyde ; benzaldehyde, 4-(methylthio)- ; 4-(Methylsulfanyl)benzaldehyd . 4-(methylthio)benzaldehyde (CAS NO.3446-89-7) is stable under normaltemperatures and pressures.but incompatible with strong oxidizingagents. It is a clear yellow liquid. |
| HS Code: | 29309070 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Stench |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
