| Identification |
| Name: | Benzene,1-(chloromethyl)-2-fluoro- |
| Synonyms: | Toluene,a-chloro-o-fluoro- (6CI,7CI,8CI);1-(Chloromethyl)-2-fluorobenzene;2-Fluorophenylmethylchloride;NSC 88295;o-fluorobenzyl chloride;a-Chloro-2-fluorotoluene; |
| CAS: | 345-35-7 |
| EINECS: | 206-460-0 |
| Molecular Formula: | C7H6ClF |
| Molecular Weight: | 144.58 |
| InChI: | InChI=1/C7H6ClF/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 8/PG 2 |
| Density: | 1.216 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.514-1.516 |
| Solubility: | Insoluble |
| Appearance: | Colorless to light yellow liquid |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. Store protected from moisture. Do not store in steel container. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
