| Identification | |
| Name: | 1,4-Naphthalenedione,2-methyl-, radical ion(1-) |
| Synonyms: | 2-Methyl-1,4-naphthoquinoneradical anion; 2-Methyl-1,4-naphthoquinone radical ion(1-);2-Methyl-1,4-naphthosemiquinone; Menadione semiquinone radical ion(1-);Menaquinone radical anion(1-); Vitamin K3 radical anion; Vitamin K3 semiquinone |
| CAS: | 34524-96-4 |
| Molecular Formula: | C11H8 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C11H8O2/c1-7-6-10(12)8-4-2-3-5-9(8)11(7)13/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 105-107 deg C |
| Solubility: | Slightly soluble in ethanol, acetic acid, and ligroin. Soluble in ethyl ether, benzene, chloroform, and sulfuric acid. One gram dissolves in about 60 ml alcohol, in 10 ml benzene, in 50 ml vegetable oils; moderately soluble in chloroform, carbon tetrachloride. Soluble in aromatic solvents SOL IN FATS Soluble in acetone In water, 160 mg/l @ 30 deg C |
| Color: | Bright yellow crystals YELLOW NEEDLES FROM ALC, PETROLEUM ETHER |
| Safety Data | |
 |
|
