| Identification | |
| Name: | 2-(1-Sec-butyl-2-(dimethylamino)ethyl) thiophene |
| CAS: | 34548-72-6 |
| Molecular Formula: | C12H21NS |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H21NS/c1-5-10(2)11(9-13(3)4)12-7-6-8-14-12/h6-8,10-11H,5,9H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 119.8°C |
| Boiling Point: | 274.4°C at 760 mmHg |
| Density: | 0.964g/cm3 |
| Refractive index: | 1.511 |
| Specification: |
2-(1-Sec-butyl-2-(dimethylamino)ethyl) thiophene (CAS NO.34548-72-6) belongs to a highly toxic highly toxic, with flammable, toxic and hazardous characteristics of thermal decomposition of sulfur oxide emissions, nitrogen oxide fumes need for ventilation in dry and cold environment, storage and transportation;, and separate with food ingredients ; fire extinguishing agent options are mainly water , dry powder, carbon dioxide, foam fire extinguishing agent. |
| Flash Point: | 119.8°C |
| Safety Data | |
 |
|
