| Identification | |
| Name: | Propanol, 1(or2)-(2-methoxymethylethoxy)- |
| Synonyms: | Dipropyleneglycol monomethyl ether (6CI,7CI);Arcosolv DPM;Dipropylene glycol methylether;Dowanol DPM;Glysolv DPM;Kino-red;Methoxypropoxypropanol;MethylDipropasol;Oxybispropanol methyl ether;PPG-2 methyl ether; |
| CAS: | 34590-94-8 |
| EINECS: | 252-104-2 |
| Molecular Formula: | C7H16O3 |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C7H16O3/c1-6(4-8)10-5-7(2)9-3/h6-8H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -80 C BOLING |
| Flash Point: | 166? |
| Density: | 0.951 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.422 |
| Water Solubility: | completely (and miscible with a number of organic solvents) |
| Solubility: | completely (and miscible with a number of organic solvents) |
| Appearance: | colorless liquid with mild pleasant odor |
| Packinggroup: | Z01 |
| HS Code: | 29094919 |
| Flash Point: | 166? |
| Storage Temperature: | In general, toxic materials or that can decompose into toxic components should be stored in cool ventilated place, out of sun, away from fire hazard. Substance must be periodically inspected and monitored. Incompatible materials should be isolated. |
| Color: | COLORLESS LIQUID Colorless liquid. |
| Usage: | In manufacture of various cosmetics. |
| Safety Data | |
| Hazard Symbols | |
 |
|
